![5-methoxy-1H-pyrazolo[3,4-c]pyridine (CAS: 76006-07-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0739787.png "5-methoxy-1H-pyrazolo[3,4-c]pyridine chemical structure")
5-methoxy-1H-pyrazolo[3,4-c]pyridine
Catalog No: FT-0739787
CAS No: 76006-07-0
- Chemical Name: 5-methoxy-1H-pyrazolo[3,4-c]pyridine
- Molecular Formula: C7H7N3O
- Molecular Weight: 149.15
- InChI Key: YLHHBXAFEMTGOY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7N3O/c1-11-7-2-5-3-9-10-6(5)4-8-7/h2-4H,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 76006-07-0 |
|---|---|
| MF: | C7H7N3O |
| Density: | 1.328g/cm3 |
| Flash_Point: | 117.434ºC |
| Melting_Point: | N/A |
| Product_Name: | 5-methoxy-1h-pyrazolo[3,4-c]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | 320.472ºC at 760 mmHg |
| FW: | 149.15000 |
| Density: | 1.328g/cm3 |
|---|---|
| MF: | C7H7N3O |
| LogP: | 0.96650 |
| Exact_Mass: | 149.05900 |
| Bolling_Point: | 320.472ºC at 760 mmHg |
| Flash_Point: | 117.434ºC |
| FW: | 149.15000 |
| Refractive_Index: | 1.658 |
| PSA: | 50.80000 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302-H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
